C18H24N2O — CID 14488758
2-[(2S,4aR,10bR)-7-hydroxy-4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-2-yl]acetonitrile (PubChem CID 14488758) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[(2S,4aR,10bR)-7-hydroxy-4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-2-yl]acetonitrile.
| Compound Name | 2-[(2S,4aR,10bR)-7-hydroxy-4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 14488758 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[(2S,4aR,10bR)-7-hydroxy-4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-2-yl]acetonitrile |
| SMILES | CCCN1C[C@H](CC#N)C[C@@H]2c3cccc(O)c3CC[C@H]21 |
| InChI | InChI=1S/C18H24N2O/c1-2-10-20-12-13(8-9-19)11-16-14-4-3-5-18(21)15(14)6-7-17(16)20/h3-5,13,16-17,21H,2,6-8,10-12H2,1H3/t13-,16-,17-/m1/s1 |
| InChIKey | VNNRJJRWTQEDPL-KBRIMQKVSA-N |
| XLogP | 3.44 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |