C26H30N2O2S — CID 144887595
4-[4H-azepin-7-yl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]benzoic acid (PubChem CID 144887595) has the molecular formula C26H30N2O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is 4-[4H-azepin-7-yl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]benzoic acid.
| Compound Name | 4-[4H-azepin-7-yl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 144887595 |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 4-[4H-azepin-7-yl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]benzoic acid |
| SMILES | Cc1c(N(C2=NC=CCC=C2)c2ccc(C(=O)O)cc2)sc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H30N2O2S/c1-17-21-22(26(4,5)15-14-25(21,2)3)31-23(17)28(20-9-7-6-8-16-27-20)19-12-10-18(11-13-19)24(29)30/h7-13,16H,6,14-15H2,1-5H3,(H,29,30) |
| InChIKey | XXFZVDQLDWWBIV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |