C28H28F3N7O — CID 144888868
N-methyl-4-[2-(6-methylimidazo[1,2-b]pyridazin-3-yl)ethynyl]pyridin-2-amine;4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)benzaldehyde (PubChem CID 144888868) has the molecular formula C28H28F3N7O and a molecular weight of 535.57 g/mol. Its IUPAC name is N-methyl-4-[2-(6-methylimidazo[1,2-b]pyridazin-3-yl)ethynyl]pyridin-2-amine;4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)benzaldehyde.
| Compound Name | N-methyl-4-[2-(6-methylimidazo[1,2-b]pyridazin-3-yl)ethynyl]pyridin-2-amine;4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 144888868 |
| Molecular Formula | C28H28F3N7O |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-methyl-4-[2-(6-methylimidazo[1,2-b]pyridazin-3-yl)ethynyl]pyridin-2-amine;4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)benzaldehyde |
| SMILES | CNc1cc(C#Cc2cnc3ccc(C)nn23)ccn1.O=Cc1ccc(CN2CCNCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13N5.C13H15F3N2O/c1-11-3-6-15-18-10-13(20(15)19-11)5-4-12-7-8-17-14(9-12)16-2;14-13(15,16)12-7-10(9-19)1-2-11(12)8-18-5-3-17-4-6-18/h3,6-10H,1-2H3,(H,16,17);1-2,7,9,17H,3-6,8H2 |
| InChIKey | KRAHJFXGRHKAGO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|