About 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine
1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine (PubChem CID 144888887) has the molecular formula C13H19F3N2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine.
Molecular Properties
| Compound Name | 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine |
| PubChem CID | 144888887 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine |
| SMILES | C=C(CN1CCNCC1)/C(=C\C=C/C)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-3-4-5-12(13(14,15)16)11(2)10-18-8-6-17-7-9-18/h3-5,17H,2,6-10H2,1H3/b4-3-,12-5+ |
| InChIKey | KBWBNOGOSSEYLN-IVNKHWRPSA-N |
| XLogP | 2.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine?
The IUPAC name of 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine (CID 144888887) is 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine.
What is the SMILES notation for 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine?
The canonical SMILES for 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine is C=C(CN1CCNCC1)/C(=C\C=C/C)C(F)(F)F.
What is the InChIKey of 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine?
The InChIKey is KBWBNOGOSSEYLN-IVNKHWRPSA-N. The full InChI is InChI=1S/C13H19F3N2/c1-3-4-5-12(13(14,15)16)11(2)10-18-8-6-17-7-9-18/h3-5,17H,2,6-10H2,1H3/b4-3-,12-5+.
What are the key properties of 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine?
1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine has a molecular weight of 260.30 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E,5Z)-2-methylidene-3-(trifluoromethyl)hepta-3,5-dienyl]piperazine is sourced from PubChem (CID 144888887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).