C22H19N5O2S — CID 144889006
tert-butyl N-[5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-1,3-thiazol-2-yl]-N-phenylcarbamate (PubChem CID 144889006) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is tert-butyl N-[5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-1,3-thiazol-2-yl]-N-phenylcarbamate.
| Compound Name | tert-butyl N-[5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-1,3-thiazol-2-yl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 144889006 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | tert-butyl N-[5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-1,3-thiazol-2-yl]-N-phenylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccccc1)c1ncc(C#Cc2cnc3cccnn23)s1 |
| InChI | InChI=1S/C22H19N5O2S/c1-22(2,3)29-21(28)26(16-8-5-4-6-9-16)20-24-15-18(30-20)12-11-17-14-23-19-10-7-13-25-27(17)19/h4-10,13-15H,1-3H3 |
| InChIKey | TWWFMOHIFOEBOL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|