C16H25N5OS — CID 144889150
5-(2-amino-4-pyridinyl)-N-(dimethylamino-methylidene-oxo-λ6-sulfanyl)-2-methylpyridin-3-amine;ethane (PubChem CID 144889150) has the molecular formula C16H25N5OS and a molecular weight of 335.48 g/mol. Its IUPAC name is 5-(2-amino-4-pyridinyl)-N-(dimethylamino-methylidene-oxo-λ6-sulfanyl)-2-methylpyridin-3-amine;ethane.
| Compound Name | 5-(2-amino-4-pyridinyl)-N-(dimethylamino-methylidene-oxo-λ6-sulfanyl)-2-methylpyridin-3-amine;ethane |
|---|---|
| PubChem CID | 144889150 |
| Molecular Formula | C16H25N5OS |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 5-(2-amino-4-pyridinyl)-N-(dimethylamino-methylidene-oxo-λ6-sulfanyl)-2-methylpyridin-3-amine;ethane |
| SMILES | C=S(=O)(Nc1cc(-c2ccnc(N)c2)cnc1C)N(C)C.CC |
| InChI | InChI=1S/C14H19N5OS.C2H6/c1-10-13(18-21(4,20)19(2)3)7-12(9-17-10)11-5-6-16-14(15)8-11;1-2/h5-9H,4H2,1-3H3,(H2,15,16)(H,18,20);1-2H3 |
| InChIKey | ZOGKAQVDYDMZLX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|