About ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane
ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane (PubChem CID 144889249) has the molecular formula C8H23NO2
and a molecular weight of 165.28 g/mol. Its IUPAC name is ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane.
Molecular Properties
| Compound Name | ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane |
| PubChem CID | 144889249 |
| Molecular Formula | C8H23NO2 |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.17 |
| IUPAC Name | ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane |
| SMILES | CC.COC.COCN(C)C |
| InChI | InChI=1S/C4H11NO.C2H6O.C2H6/c1-5(2)4-6-3;1-3-2;1-2/h4H2,1-3H3;1-2H3;1-2H3 |
| InChIKey | VHIBICQCWUYMSW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane?
The IUPAC name of ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane (CID 144889249) is ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane.
What is the SMILES notation for ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane?
The canonical SMILES for ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane is CC.COC.COCN(C)C.
What is the InChIKey of ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane?
The InChIKey is VHIBICQCWUYMSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.C2H6O.C2H6/c1-5(2)4-6-3;1-3-2;1-2/h4H2,1-3H3;1-2H3;1-2H3.
What are the key properties of ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane?
ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane has a molecular weight of 165.28 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-N,N-dimethylmethanamine;methoxymethane is sourced from PubChem (CID 144889249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).