About 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane
2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane (PubChem CID 144889254) has the molecular formula C8H9BrClN3S
and a molecular weight of 294.61 g/mol. Its IUPAC name is 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane.
Molecular Properties
| Compound Name | 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane |
| PubChem CID | 144889254 |
| Molecular Formula | C8H9BrClN3S |
| Molecular Weight | 294.61 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane |
| SMILES | Clc1ncc(Br)cc1N1CCCNS1 |
| InChI | InChI=1S/C8H9BrClN3S/c9-6-4-7(8(10)11-5-6)13-3-1-2-12-14-13/h4-5,12H,1-3H2 |
| InChIKey | ZKKOMOBIHUYHJN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane?
The IUPAC name of 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane (CID 144889254) is 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane.
What is the SMILES notation for 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane?
The canonical SMILES for 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane is Clc1ncc(Br)cc1N1CCCNS1.
What is the InChIKey of 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane?
The InChIKey is ZKKOMOBIHUYHJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrClN3S/c9-6-4-7(8(10)11-5-6)13-3-1-2-12-14-13/h4-5,12H,1-3H2.
What are the key properties of 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane?
2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane has a molecular weight of 294.61 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-2-chloro-3-pyridinyl)-1,2,6-thiadiazinane is sourced from PubChem (CID 144889254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).