About N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide
N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide (PubChem CID 144889445) has the molecular formula C19H19FN4OS
and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide |
| PubChem CID | 144889445 |
| Molecular Formula | C19H19FN4OS |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide |
| SMILES | Cc1cc(-c2cnc(C)c(NSc3cccc(F)c3)c2)ccn1.NC=O |
| InChI | InChI=1S/C18H16FN3S.CH3NO/c1-12-8-14(6-7-20-12)15-9-18(13(2)21-11-15)22-23-17-5-3-4-16(19)10-17;2-1-3/h3-11,22H,1-2H3;1H,(H2,2,3) |
| InChIKey | YYFJKMZZVAOYEF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide?
The IUPAC name of N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide (CID 144889445) is N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide.
What is the SMILES notation for N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide?
The canonical SMILES for N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide is Cc1cc(-c2cnc(C)c(NSc3cccc(F)c3)c2)ccn1.NC=O.
What is the InChIKey of N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide?
The InChIKey is YYFJKMZZVAOYEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3S.CH3NO/c1-12-8-14(6-7-20-12)15-9-18(13(2)21-11-15)22-23-17-5-3-4-16(19)10-17;2-1-3/h3-11,22H,1-2H3;1H,(H2,2,3).
What are the key properties of N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide?
N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide has a molecular weight of 370.45 g/mol, XLogP of 4.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)sulfanyl-2-methyl-5-(2-methyl-4-pyridinyl)pyridin-3-amine;formamide is sourced from PubChem (CID 144889445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).