About CID 144889761
CID 144889761 (PubChem CID 144889761) has the molecular formula C6H17N3NaO3+
and a molecular weight of 202.21 g/mol.
Molecular Properties
| Compound Name | CID 144889761 |
| PubChem CID | 144889761 |
| Molecular Formula | C6H17N3NaO3+ |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | — |
| SMILES | N[O-].OCC1CCN([NH2+]O)CC1.[Na+] |
| InChI | InChI=1S/C6H14N2O2.H2NO.Na/c9-5-6-1-3-8(7-10)4-2-6;1-2;/h6-7,9-10H,1-5H2;1H2;/q;-1;+1/p+1 |
| InChIKey | YHYRBELAWXPCSA-UHFFFAOYSA-O |
| XLogP | -4.99 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 144889761 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144889761?
The IUPAC name of CID 144889761 (CID 144889761) is not available.
What is the SMILES notation for CID 144889761?
The canonical SMILES for CID 144889761 is N[O-].OCC1CCN([NH2+]O)CC1.[Na+].
What is the InChIKey of CID 144889761?
The InChIKey is YHYRBELAWXPCSA-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H14N2O2.H2NO.Na/c9-5-6-1-3-8(7-10)4-2-6;1-2;/h6-7,9-10H,1-5H2;1H2;/q;-1;+1/p+1.
What are the key properties of CID 144889761?
CID 144889761 has a molecular weight of 202.21 g/mol, XLogP of -4.99, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144889761 is sourced from PubChem (CID 144889761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).