C15H12Cl2F3N3O5 — CID 144889819
(Z)-azetidin-1-yl-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium (PubChem CID 144889819) has the molecular formula C15H12Cl2F3N3O5 and a molecular weight of 442.18 g/mol. Its IUPAC name is (Z)-azetidin-1-yl-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium.
| Compound Name | (Z)-azetidin-1-yl-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium |
|---|---|
| PubChem CID | 144889819 |
| Molecular Formula | C15H12Cl2F3N3O5 |
| Molecular Weight | 442.18 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | (Z)-azetidin-1-yl-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium |
| SMILES | O=C(OCO/N=[N+](\[O-])N1CCC1)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C15H12Cl2F3N3O5/c16-9-4-8-5-10(13(15(18,19)20)28-12(8)11(17)6-9)14(24)26-7-27-21-23(25)22-2-1-3-22/h4-6,13H,1-3,7H2/b23-21-/t13-/m0/s1 |
| InChIKey | ZZHSLCNOIJLDJD-KXPYNAFFSA-N |
| XLogP | 3.72 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|