C18H26ClF3N3O13+ — CID 144889975
1-aminooxyethyl 6-chloro-2-(trifluoromethyl)-5,7-bis(trihydroxymethyl)-2H-chromene-3-carboxylate;hydroxyazanium;2-(methylamino)acetic acid (PubChem CID 144889975) has the molecular formula C18H26ClF3N3O13+ and a molecular weight of 584.86 g/mol. Its IUPAC name is 1-aminooxyethyl 6-chloro-2-(trifluoromethyl)-5,7-bis(trihydroxymethyl)-2H-chromene-3-carboxylate;hydroxyazanium;2-(methylamino)acetic acid.
| Compound Name | 1-aminooxyethyl 6-chloro-2-(trifluoromethyl)-5,7-bis(trihydroxymethyl)-2H-chromene-3-carboxylate;hydroxyazanium;2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 144889975 |
| Molecular Formula | C18H26ClF3N3O13+ |
| Molecular Weight | 584.86 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 1-aminooxyethyl 6-chloro-2-(trifluoromethyl)-5,7-bis(trihydroxymethyl)-2H-chromene-3-carboxylate;hydroxyazanium;2-(methylamino)acetic acid |
| SMILES | CC(ON)OC(=O)C1=Cc2c(cc(C(O)(O)O)c(Cl)c2C(O)(O)O)OC1C(F)(F)F.CNCC(=O)O.[NH3+]O |
| InChI | InChI=1S/C15H15ClF3NO10.C3H7NO2.H4NO/c1-4(30-20)28-12(21)6-2-5-8(29-11(6)13(17,18)19)3-7(14(22,23)24)10(16)9(5)15(25,26)27;1-4-2-3(5)6;1-2/h2-4,11,22-27H,20H2,1H3;4H,2H2,1H3,(H,5,6);2H,1H3/q;;+1 |
| InChIKey | MRITXLNNAMGLJG-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 289.36 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.86 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|