C19H21F3N6O2 — CID 144890360
7,8-dimethyl-N-[4-(4-methylimidazol-1-yl)-3-(trifluoromethoxy)phenyl]-3,6,7,8a-tetrahydropyrimido[5,4-b][1,4]oxazin-2-amine (PubChem CID 144890360) has the molecular formula C19H21F3N6O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 7,8-dimethyl-N-[4-(4-methylimidazol-1-yl)-3-(trifluoromethoxy)phenyl]-3,6,7,8a-tetrahydropyrimido[5,4-b][1,4]oxazin-2-amine.
| Compound Name | 7,8-dimethyl-N-[4-(4-methylimidazol-1-yl)-3-(trifluoromethoxy)phenyl]-3,6,7,8a-tetrahydropyrimido[5,4-b][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 144890360 |
| Molecular Formula | C19H21F3N6O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 7,8-dimethyl-N-[4-(4-methylimidazol-1-yl)-3-(trifluoromethoxy)phenyl]-3,6,7,8a-tetrahydropyrimido[5,4-b][1,4]oxazin-2-amine |
| SMILES | Cc1cn(-c2ccc(NC3=NC4C(=CN3)OCC(C)N4C)cc2OC(F)(F)F)cn1 |
| InChI | InChI=1S/C19H21F3N6O2/c1-11-8-28(10-24-11)14-5-4-13(6-15(14)30-19(20,21)22)25-18-23-7-16-17(26-18)27(3)12(2)9-29-16/h4-8,10,12,17H,9H2,1-3H3,(H2,23,25,26) |
| InChIKey | AFYDZRRIWUBGQO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |