C13H16N2O — CID 144891847
4-methoxy-1,6-dimethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole (PubChem CID 144891847) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-methoxy-1,6-dimethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole.
| Compound Name | 4-methoxy-1,6-dimethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole |
|---|---|
| PubChem CID | 144891847 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-methoxy-1,6-dimethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole |
| SMILES | COc1cc2c(c3c(C)c[nH]c13)CCN2C |
| InChI | InChI=1S/C13H16N2O/c1-8-7-14-13-11(16-3)6-10-9(12(8)13)4-5-15(10)2/h6-7,14H,4-5H2,1-3H3 |
| InChIKey | UPZNGLREGQAGRB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |