C6H6BrClO — CID 144892135
(3E)-3-bromo-5-chlorohexa-1,3,5-trien-2-ol (PubChem CID 144892135) has the molecular formula C6H6BrClO and a molecular weight of 209.47 g/mol. Its IUPAC name is (3E)-3-bromo-5-chlorohexa-1,3,5-trien-2-ol.
| Compound Name | (3E)-3-bromo-5-chlorohexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 144892135 |
| Molecular Formula | C6H6BrClO |
| Molecular Weight | 209.47 g/mol |
| Exact Mass | 207.93 |
| IUPAC Name | (3E)-3-bromo-5-chlorohexa-1,3,5-trien-2-ol |
| SMILES | C=C(Cl)/C=C(/Br)C(=C)O |
| InChI | InChI=1S/C6H6BrClO/c1-4(8)3-6(7)5(2)9/h3,9H,1-2H2/b6-3+ |
| InChIKey | SZOHCEZXJLQPRQ-ZZXKWVIFSA-N |
| XLogP | 3.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|