C36H36N6O6S — CID 144892167
4-[4-(dimethylamino)anilino]-5-[4-(dimethylamino)-N-(4-methylphenyl)sulfonylanilino]-2-hydroxy-N-(4-nitrophenyl)benzamide (PubChem CID 144892167) has the molecular formula C36H36N6O6S and a molecular weight of 680.79 g/mol. Its IUPAC name is 4-[4-(dimethylamino)anilino]-5-[4-(dimethylamino)-N-(4-methylphenyl)sulfonylanilino]-2-hydroxy-N-(4-nitrophenyl)benzamide.
| Compound Name | 4-[4-(dimethylamino)anilino]-5-[4-(dimethylamino)-N-(4-methylphenyl)sulfonylanilino]-2-hydroxy-N-(4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 144892167 |
| Molecular Formula | C36H36N6O6S |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | 4-[4-(dimethylamino)anilino]-5-[4-(dimethylamino)-N-(4-methylphenyl)sulfonylanilino]-2-hydroxy-N-(4-nitrophenyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc(N(C)C)cc2)c2cc(C(=O)Nc3ccc([N+](=O)[O-])cc3)c(O)cc2Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H36N6O6S/c1-24-6-20-31(21-7-24)49(47,48)41(29-18-16-28(17-19-29)40(4)5)34-22-32(36(44)38-26-10-14-30(15-11-26)42(45)46)35(43)23-33(34)37-25-8-12-27(13-9-25)39(2)3/h6-23,37,43H,1-5H3,(H,38,44) |
| InChIKey | NYKUAAYCXHMWTJ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 148.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|