C19H21N7O2S — CID 144893266
N'-amino-2-[4-[(pyrimidin-4-ylmethylamino)methyl]phenyl]-6-sulfamoylbenzenecarboximidamide (PubChem CID 144893266) has the molecular formula C19H21N7O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is N'-amino-2-[4-[(pyrimidin-4-ylmethylamino)methyl]phenyl]-6-sulfamoylbenzenecarboximidamide.
| Compound Name | N'-amino-2-[4-[(pyrimidin-4-ylmethylamino)methyl]phenyl]-6-sulfamoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 144893266 |
| Molecular Formula | C19H21N7O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N'-amino-2-[4-[(pyrimidin-4-ylmethylamino)methyl]phenyl]-6-sulfamoylbenzenecarboximidamide |
| SMILES | N/N=C(\N)c1c(-c2ccc(CNCc3ccncn3)cc2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C19H21N7O2S/c20-19(26-21)18-16(2-1-3-17(18)29(22,27)28)14-6-4-13(5-7-14)10-24-11-15-8-9-23-12-25-15/h1-9,12,24H,10-11,21H2,(H2,20,26)(H2,22,27,28) |
| InChIKey | BVVGCCJYJSCBBK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|