C17H23N7S — CID 144893559
2-aminosulfanyl-N'-hydrazinyl-6-(6-piperidin-1-yl-3-pyridinyl)benzenecarboximidamide (PubChem CID 144893559) has the molecular formula C17H23N7S and a molecular weight of 357.49 g/mol. Its IUPAC name is 2-aminosulfanyl-N'-hydrazinyl-6-(6-piperidin-1-yl-3-pyridinyl)benzenecarboximidamide.
| Compound Name | 2-aminosulfanyl-N'-hydrazinyl-6-(6-piperidin-1-yl-3-pyridinyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 144893559 |
| Molecular Formula | C17H23N7S |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-aminosulfanyl-N'-hydrazinyl-6-(6-piperidin-1-yl-3-pyridinyl)benzenecarboximidamide |
| SMILES | NN/N=C(\N)c1c(SN)cccc1-c1ccc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C17H23N7S/c18-17(22-23-19)16-13(5-4-6-14(16)25-20)12-7-8-15(21-11-12)24-9-2-1-3-10-24/h4-8,11,23H,1-3,9-10,19-20H2,(H2,18,22) |
| InChIKey | IBCLITSIWKFTBZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|