About (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane
(3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane (PubChem CID 144894451) has the molecular formula C8H13N3S
and a molecular weight of 183.28 g/mol. Its IUPAC name is (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane.
Molecular Properties
| Compound Name | (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane |
| PubChem CID | 144894451 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane |
| SMILES | CC.N#CC[C@H](N)c1ccns1 |
| InChI | InChI=1S/C6H7N3S.C2H6/c7-3-1-5(8)6-2-4-9-10-6;1-2/h2,4-5H,1,8H2;1-2H3/t5-;/m0./s1 |
| InChIKey | LXPXWQHTHXBXFB-JEDNCBNOSA-N |
| XLogP | 2.08 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane?
The IUPAC name of (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane (CID 144894451) is (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane.
What is the SMILES notation for (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane?
The canonical SMILES for (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane is CC.N#CC[C@H](N)c1ccns1.
What is the InChIKey of (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane?
The InChIKey is LXPXWQHTHXBXFB-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H7N3S.C2H6/c7-3-1-5(8)6-2-4-9-10-6;1-2/h2,4-5H,1,8H2;1-2H3/t5-;/m0./s1.
What are the key properties of (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane?
(3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane has a molecular weight of 183.28 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-3-(1,2-thiazol-5-yl)propanenitrile;ethane is sourced from PubChem (CID 144894451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).