C16H29N — CID 144895142
1-(3-butyl-4-ethylcyclohexa-1,3-dien-1-yl)butan-2-amine (PubChem CID 144895142) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 1-(3-butyl-4-ethylcyclohexa-1,3-dien-1-yl)butan-2-amine.
| Compound Name | 1-(3-butyl-4-ethylcyclohexa-1,3-dien-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 144895142 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 1-(3-butyl-4-ethylcyclohexa-1,3-dien-1-yl)butan-2-amine |
| SMILES | CCCCC1=C(CC)CCC(CC(N)CC)=C1 |
| InChI | InChI=1S/C16H29N/c1-4-7-8-15-11-13(12-16(17)6-3)9-10-14(15)5-2/h11,16H,4-10,12,17H2,1-3H3 |
| InChIKey | HLQMABHVVAGATB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |