C26H38N4O4 — CID 144895584
ethane;N-methyl-2-[(5-nitro-1,2,3,4-tetrahydroquinolin-8-yl)oxy]acetamide;1-(2-phenylethyl)pyrrolidine (PubChem CID 144895584) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is ethane;N-methyl-2-[(5-nitro-1,2,3,4-tetrahydroquinolin-8-yl)oxy]acetamide;1-(2-phenylethyl)pyrrolidine.
| Compound Name | ethane;N-methyl-2-[(5-nitro-1,2,3,4-tetrahydroquinolin-8-yl)oxy]acetamide;1-(2-phenylethyl)pyrrolidine |
|---|---|
| PubChem CID | 144895584 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | ethane;N-methyl-2-[(5-nitro-1,2,3,4-tetrahydroquinolin-8-yl)oxy]acetamide;1-(2-phenylethyl)pyrrolidine |
| SMILES | CC.CNC(=O)COc1ccc([N+](=O)[O-])c2c1NCCC2.c1ccc(CCN2CCCC2)cc1 |
| InChI | InChI=1S/C12H15N3O4.C12H17N.C2H6/c1-13-11(16)7-19-10-5-4-9(15(17)18)8-3-2-6-14-12(8)10;1-2-6-12(7-3-1)8-11-13-9-4-5-10-13;1-2/h4-5,14H,2-3,6-7H2,1H3,(H,13,16);1-3,6-7H,4-5,8-11H2;1-2H3 |
| InChIKey | MMKYIIBYFKMGTH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|