About 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one
1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one (PubChem CID 14489646) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one |
| PubChem CID | 14489646 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one |
| SMILES | CN1C(=O)CC=CC1CN1CCCCC1 |
| InChI | InChI=1S/C12H20N2O/c1-13-11(6-5-7-12(13)15)10-14-8-3-2-4-9-14/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | UGOMMBVNCNPCPD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one?
The IUPAC name of 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one (CID 14489646) is 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one.
What is the SMILES notation for 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one?
The canonical SMILES for 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one is CN1C(=O)CC=CC1CN1CCCCC1.
What is the InChIKey of 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one?
The InChIKey is UGOMMBVNCNPCPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-13-11(6-5-7-12(13)15)10-14-8-3-2-4-9-14/h5-6,11H,2-4,7-10H2,1H3.
What are the key properties of 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one?
1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one has a molecular weight of 208.30 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(piperidin-1-ylmethyl)-2,5-dihydropyridin-6-one is sourced from PubChem (CID 14489646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).