C57H47BN2O2 — CID 144896848
2-[3-[9-(9,9-dimethylfluoren-3-yl)carbazol-2-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9-phenylcarbazole (PubChem CID 144896848) has the molecular formula C57H47BN2O2 and a molecular weight of 802.83 g/mol. Its IUPAC name is 2-[3-[9-(9,9-dimethylfluoren-3-yl)carbazol-2-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9-phenylcarbazole.
| Compound Name | 2-[3-[9-(9,9-dimethylfluoren-3-yl)carbazol-2-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 144896848 |
| Molecular Formula | C57H47BN2O2 |
| Molecular Weight | 802.83 g/mol |
| Exact Mass | 802.37 |
| IUPAC Name | 2-[3-[9-(9,9-dimethylfluoren-3-yl)carbazol-2-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9-phenylcarbazole |
| SMILES | CC1(C)c2ccccc2-c2cc(-n3c4ccccc4c4ccc(-c5cc(B6OC(C)(C)C(C)(C)O6)cc(-c6ccc7c8ccccc8n(-c8ccccc8)c7c6)c5)cc43)ccc21 |
| InChI | InChI=1S/C57H47BN2O2/c1-55(2)49-21-13-10-18-43(49)48-35-42(26-29-50(48)55)60-52-23-15-12-20-45(52)47-28-25-37(34-54(47)60)39-30-38(31-40(32-39)58-61-56(3,4)57(5,6)62-58)36-24-27-46-44-19-11-14-22-51(44)59(53(46)33-36)41-16-8-7-9-17-41/h7-35H,1-6H3 |
| InChIKey | CSVLJPDPXPWFDY-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.83 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|