C27H29ClN4O2S — CID 144897466
1-(3-chlorophenyl)-3-(4-methylphenyl)pyrazole-4-carbaldehyde;2-[[2-methyl-5-(methylamino)phenyl]sulfanylamino]ethanol (PubChem CID 144897466) has the molecular formula C27H29ClN4O2S and a molecular weight of 509.08 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(4-methylphenyl)pyrazole-4-carbaldehyde;2-[[2-methyl-5-(methylamino)phenyl]sulfanylamino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-3-(4-methylphenyl)pyrazole-4-carbaldehyde;2-[[2-methyl-5-(methylamino)phenyl]sulfanylamino]ethanol |
|---|---|
| PubChem CID | 144897466 |
| Molecular Formula | C27H29ClN4O2S |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(4-methylphenyl)pyrazole-4-carbaldehyde;2-[[2-methyl-5-(methylamino)phenyl]sulfanylamino]ethanol |
| SMILES | CNc1ccc(C)c(SNCCO)c1.Cc1ccc(-c2nn(-c3cccc(Cl)c3)cc2C=O)cc1 |
| InChI | InChI=1S/C17H13ClN2O.C10H16N2OS/c1-12-5-7-13(8-6-12)17-14(11-21)10-20(19-17)16-4-2-3-15(18)9-16;1-8-3-4-9(11-2)7-10(8)14-12-5-6-13/h2-11H,1H3;3-4,7,11-13H,5-6H2,1-2H3 |
| InChIKey | NLTLRGUYDGCLTQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|