C31H29ClF3N7O2 — CID 144897713
14-[4-[2-[amino-[(Z)-2-amino-3,3-difluoroprop-1-enyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-4-fluoro-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one (PubChem CID 144897713) has the molecular formula C31H29ClF3N7O2 and a molecular weight of 624.07 g/mol. Its IUPAC name is 14-[4-[2-[amino-[(Z)-2-amino-3,3-difluoroprop-1-enyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-4-fluoro-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one.
| Compound Name | 14-[4-[2-[amino-[(Z)-2-amino-3,3-difluoroprop-1-enyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-4-fluoro-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 144897713 |
| Molecular Formula | C31H29ClF3N7O2 |
| Molecular Weight | 624.07 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | 14-[4-[2-[amino-[(Z)-2-amino-3,3-difluoroprop-1-enyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-4-fluoro-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
| SMILES | CC1CCCC(n2cnc(-c3cc(Cl)ccc3N(N)/C=C(\N)C(F)F)cc2=O)c2cc(ccn2)-c2cc(F)ccc2NC1=O |
| InChI | InChI=1S/C31H29ClF3N7O2/c1-17-3-2-4-28(26-11-18(9-10-38-26)21-13-20(33)6-7-24(21)40-31(17)44)41-16-39-25(14-29(41)43)22-12-19(32)5-8-27(22)42(37)15-23(36)30(34)35/h5-17,28,30H,2-4,36-37H2,1H3,(H,40,44)/b23-15- |
| InChIKey | NTVZCKGBLLEAMN-HAHDFKILSA-N |
| XLogP | 5.86 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.07 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|