About methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane
methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane (PubChem CID 144897889) has the molecular formula C20H23F3N2O2
and a molecular weight of 380.41 g/mol. Its IUPAC name is methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane.
Molecular Properties
| Compound Name | methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane |
| PubChem CID | 144897889 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane |
| SMILES | CCC.COC(=O)c1cnc2c(c1)CN(Cc1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C17H15F3N2O2.C3H8/c1-24-16(23)12-6-13-9-22(10-15(13)21-7-12)8-11-2-4-14(5-3-11)17(18,19)20;1-3-2/h2-7H,8-10H2,1H3;3H2,1-2H3 |
| InChIKey | JCAWYBSECBIGJZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane?
The IUPAC name of methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane (CID 144897889) is methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane.
What is the SMILES notation for methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane?
The canonical SMILES for methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane is CCC.COC(=O)c1cnc2c(c1)CN(Cc1ccc(C(F)(F)F)cc1)C2.
What is the InChIKey of methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane?
The InChIKey is JCAWYBSECBIGJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N2O2.C3H8/c1-24-16(23)12-6-13-9-22(10-15(13)21-7-12)8-11-2-4-14(5-3-11)17(18,19)20;1-3-2/h2-7H,8-10H2,1H3;3H2,1-2H3.
What are the key properties of methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane?
methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane has a molecular weight of 380.41 g/mol, XLogP of 4.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxylate;propane is sourced from PubChem (CID 144897889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).