C14H17FO5S — CID 14489796
ethyl 2-(benzenesulfonyl)-2-fluoro-5-oxohexanoate (PubChem CID 14489796) has the molecular formula C14H17FO5S and a molecular weight of 316.35 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonyl)-2-fluoro-5-oxohexanoate.
| Compound Name | ethyl 2-(benzenesulfonyl)-2-fluoro-5-oxohexanoate |
|---|---|
| PubChem CID | 14489796 |
| Molecular Formula | C14H17FO5S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | ethyl 2-(benzenesulfonyl)-2-fluoro-5-oxohexanoate |
| SMILES | CCOC(=O)C(F)(CCC(C)=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17FO5S/c1-3-20-13(17)14(15,10-9-11(2)16)21(18,19)12-7-5-4-6-8-12/h4-8H,3,9-10H2,1-2H3 |
| InChIKey | UFYOMPWKPSHAET-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |