C20H19N5OS — CID 144898163
2-(4-aminosulfanylanilino)-5,11-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 144898163) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-(4-aminosulfanylanilino)-5,11-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 2-(4-aminosulfanylanilino)-5,11-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 144898163 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-(4-aminosulfanylanilino)-5,11-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | CN1C(=O)c2ccccc2N(C)c2nc(Nc3ccc(SN)cc3)ccc21 |
| InChI | InChI=1S/C20H19N5OS/c1-24-16-6-4-3-5-15(16)20(26)25(2)17-11-12-18(23-19(17)24)22-13-7-9-14(27-21)10-8-13/h3-12H,21H2,1-2H3,(H,22,23) |
| InChIKey | MVVLLAAQCMKQRH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|