C57H46N8O2 — CID 144898681
(3Z)-hexa-1,3,5-triene;(3Z)-penta-1,3-diene;10-[4-[1-[4-[4-(4-phenoxazin-10-ylphenyl)triazol-1-yl]phenyl]triazol-4-yl]phenyl]phenoxazine (PubChem CID 144898681) has the molecular formula C57H46N8O2 and a molecular weight of 875.05 g/mol. Its IUPAC name is (3Z)-hexa-1,3,5-triene;(3Z)-penta-1,3-diene;10-[4-[1-[4-[4-(4-phenoxazin-10-ylphenyl)triazol-1-yl]phenyl]triazol-4-yl]phenyl]phenoxazine.
| Compound Name | (3Z)-hexa-1,3,5-triene;(3Z)-penta-1,3-diene;10-[4-[1-[4-[4-(4-phenoxazin-10-ylphenyl)triazol-1-yl]phenyl]triazol-4-yl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 144898681 |
| Molecular Formula | C57H46N8O2 |
| Molecular Weight | 875.05 g/mol |
| Exact Mass | 874.37 |
| IUPAC Name | (3Z)-hexa-1,3,5-triene;(3Z)-penta-1,3-diene;10-[4-[1-[4-[4-(4-phenoxazin-10-ylphenyl)triazol-1-yl]phenyl]triazol-4-yl]phenyl]phenoxazine |
| SMILES | C=C/C=C\C.C=C/C=C\C=C.c1ccc2c(c1)Oc1ccccc1N2c1ccc(-c2cn(-c3ccc(-n4cc(-c5ccc(N6c7ccccc7Oc7ccccc76)cc5)nn4)cc3)nn2)cc1 |
| InChI | InChI=1S/C46H30N8O2.C6H8.C5H8/c1-5-13-43-39(9-1)53(40-10-2-6-14-44(40)55-43)35-21-17-31(18-22-35)37-29-51(49-47-37)33-25-27-34(28-26-33)52-30-38(48-50-52)32-19-23-36(24-20-32)54-41-11-3-7-15-45(41)56-46-16-8-4-12-42(46)54;1-3-5-6-4-2;1-3-5-4-2/h1-30H;3-6H,1-2H2;3-5H,1H2,2H3/b;6-5-;5-4- |
| InChIKey | FOOJACLXPPMMDS-MKWHSGTLSA-N |
| XLogP | 15.00 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.05 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|