C52H50N4O — CID 144898711
(Z)-N'-[4-(9,9-dimethylacridin-10-yl)phenyl]-1-(4-phenoxazin-10-ylphenyl)ethene-1,2-diamine;(3Z)-hexa-1,3,5-triene;(3Z)-penta-1,3-diene (PubChem CID 144898711) has the molecular formula C52H50N4O and a molecular weight of 747.00 g/mol. Its IUPAC name is (Z)-N'-[4-(9,9-dimethylacridin-10-yl)phenyl]-1-(4-phenoxazin-10-ylphenyl)ethene-1,2-diamine;(3Z)-hexa-1,3,5-triene;(3Z)-penta-1,3-diene.
| Compound Name | (Z)-N'-[4-(9,9-dimethylacridin-10-yl)phenyl]-1-(4-phenoxazin-10-ylphenyl)ethene-1,2-diamine;(3Z)-hexa-1,3,5-triene;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 144898711 |
| Molecular Formula | C52H50N4O |
| Molecular Weight | 747.00 g/mol |
| Exact Mass | 746.40 |
| IUPAC Name | (Z)-N'-[4-(9,9-dimethylacridin-10-yl)phenyl]-1-(4-phenoxazin-10-ylphenyl)ethene-1,2-diamine;(3Z)-hexa-1,3,5-triene;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.C=C/C=C\C=C.CC1(C)c2ccccc2N(c2ccc(N/C=C(\N)c3ccc(N4c5ccccc5Oc5ccccc54)cc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C41H34N4O.C6H8.C5H8/c1-41(2)32-11-3-5-13-35(32)44(36-14-6-4-12-33(36)41)31-25-21-29(22-26-31)43-27-34(42)28-19-23-30(24-20-28)45-37-15-7-9-17-39(37)46-40-18-10-8-16-38(40)45;1-3-5-6-4-2;1-3-5-4-2/h3-27,43H,42H2,1-2H3;3-6H,1-2H2;3-5H,1H2,2H3/b34-27-;6-5-;5-4- |
| InChIKey | XAYDSEYAPOEAKV-KQAIQBPQSA-N |
| XLogP | 14.40 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.00 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|