C12H16N4O4 — CID 144899862
(3R)-3-[(2-amino-4-pyridinyl)methyl]-2-(1,1-dihydroxyethyl)-4-oxoazetidine-1-carboxamide (PubChem CID 144899862) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3R)-3-[(2-amino-4-pyridinyl)methyl]-2-(1,1-dihydroxyethyl)-4-oxoazetidine-1-carboxamide.
| Compound Name | (3R)-3-[(2-amino-4-pyridinyl)methyl]-2-(1,1-dihydroxyethyl)-4-oxoazetidine-1-carboxamide |
|---|---|
| PubChem CID | 144899862 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (3R)-3-[(2-amino-4-pyridinyl)methyl]-2-(1,1-dihydroxyethyl)-4-oxoazetidine-1-carboxamide |
| SMILES | CC(O)(O)C1[C@@H](Cc2ccnc(N)c2)C(=O)N1C(N)=O |
| InChI | InChI=1S/C12H16N4O4/c1-12(19,20)9-7(10(17)16(9)11(14)18)4-6-2-3-15-8(13)5-6/h2-3,5,7,9,19-20H,4H2,1H3,(H2,13,15)(H2,14,18)/t7-,9?/m1/s1 |
| InChIKey | WSDNFPLVGJIQND-YOXFSPIKSA-N |
| XLogP | -1.19 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|