C21H26ClF3N2O4 — CID 144899939
(2S,3R)-3-[2-(5-chlorocyclohexa-2,4-dien-1-yl)ethyl]-1-[[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 144899939) has the molecular formula C21H26ClF3N2O4 and a molecular weight of 462.90 g/mol. Its IUPAC name is (2S,3R)-3-[2-(5-chlorocyclohexa-2,4-dien-1-yl)ethyl]-1-[[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[2-(5-chlorocyclohexa-2,4-dien-1-yl)ethyl]-1-[[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 144899939 |
| Molecular Formula | C21H26ClF3N2O4 |
| Molecular Weight | 462.90 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (2S,3R)-3-[2-(5-chlorocyclohexa-2,4-dien-1-yl)ethyl]-1-[[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]carbamoyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](CCC2C=CC=C(Cl)C2)C(=O)N1C(=O)N[C@@H](C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C21H26ClF3N2O4/c22-14-8-4-5-12(11-14)9-10-15-16(19(29)30)27(18(15)28)20(31)26-17(21(23,24)25)13-6-2-1-3-7-13/h4-5,8,12-13,15-17H,1-3,6-7,9-11H2,(H,26,31)(H,29,30)/t12?,15-,16+,17+/m1/s1 |
| InChIKey | JQPWPRPAWLNRPM-OPYIYSJWSA-N |
| XLogP | 4.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |