C26H28N2O3 — CID 144901040
N-(2,3-dihydro-1H-inden-4-yl)formamide;N-[1-(4-hydroxyphenyl)propan-2-yl]benzamide (PubChem CID 144901040) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-4-yl)formamide;N-[1-(4-hydroxyphenyl)propan-2-yl]benzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-4-yl)formamide;N-[1-(4-hydroxyphenyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 144901040 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-4-yl)formamide;N-[1-(4-hydroxyphenyl)propan-2-yl]benzamide |
| SMILES | CC(Cc1ccc(O)cc1)NC(=O)c1ccccc1.O=CNc1cccc2c1CCC2 |
| InChI | InChI=1S/C16H17NO2.C10H11NO/c1-12(11-13-7-9-15(18)10-8-13)17-16(19)14-5-3-2-4-6-14;12-7-11-10-6-2-4-8-3-1-5-9(8)10/h2-10,12,18H,11H2,1H3,(H,17,19);2,4,6-7H,1,3,5H2,(H,11,12) |
| InChIKey | LLBKXMHXYJEPJH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|