About ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde
ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde (PubChem CID 144901527) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde.
Molecular Properties
| Compound Name | ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde |
| PubChem CID | 144901527 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde |
| SMILES | CC.COC(C)(C)C.O=Cc1cc2cc([N+](=O)[O-])ccc2[nH]1 |
| InChI | InChI=1S/C9H6N2O3.C5H12O.C2H6/c12-5-7-3-6-4-8(11(13)14)1-2-9(6)10-7;1-5(2,3)6-4;1-2/h1-5,10H;1-4H3;1-2H3 |
| InChIKey | MBRLVGZGOJSICJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde?
The IUPAC name of ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde (CID 144901527) is ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde.
What is the SMILES notation for ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde?
The canonical SMILES for ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde is CC.COC(C)(C)C.O=Cc1cc2cc([N+](=O)[O-])ccc2[nH]1.
What is the InChIKey of ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde?
The InChIKey is MBRLVGZGOJSICJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3.C5H12O.C2H6/c12-5-7-3-6-4-8(11(13)14)1-2-9(6)10-7;1-5(2,3)6-4;1-2/h1-5,10H;1-4H3;1-2H3.
What are the key properties of ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde?
ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde has a molecular weight of 308.38 g/mol, XLogP of 4.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-2-methylpropane;5-nitro-1H-indole-2-carbaldehyde is sourced from PubChem (CID 144901527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).