C17H26N2 — CID 144902560
(1Z,4E)-1-cyclohexa-1,5-dien-1-yl-4-methyl-3-methyliminohepta-1,4,6-trien-1-amine;ethane (PubChem CID 144902560) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (1Z,4E)-1-cyclohexa-1,5-dien-1-yl-4-methyl-3-methyliminohepta-1,4,6-trien-1-amine;ethane.
| Compound Name | (1Z,4E)-1-cyclohexa-1,5-dien-1-yl-4-methyl-3-methyliminohepta-1,4,6-trien-1-amine;ethane |
|---|---|
| PubChem CID | 144902560 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (1Z,4E)-1-cyclohexa-1,5-dien-1-yl-4-methyl-3-methyliminohepta-1,4,6-trien-1-amine;ethane |
| SMILES | C=C/C=C(C)/C(/C=C(\N)C1=CCCC=C1)=N\C.CC |
| InChI | InChI=1S/C15H20N2.C2H6/c1-4-8-12(2)15(17-3)11-14(16)13-9-6-5-7-10-13;1-2/h4,6,8-11H,1,5,7,16H2,2-3H3;1-2H3/b12-8+,14-11-,17-15-; |
| InChIKey | JDNKGVFWXHOLEW-YGCNKSCCSA-N |
| XLogP | 4.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|