About 1-(azetidin-3-yl)ethenol
1-(azetidin-3-yl)ethenol (PubChem CID 144905123) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 1-(azetidin-3-yl)ethenol.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)ethenol |
| PubChem CID | 144905123 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 1-(azetidin-3-yl)ethenol |
| SMILES | C=C(O)C1CNC1 |
| InChI | InChI=1S/C5H9NO/c1-4(7)5-2-6-3-5/h5-7H,1-3H2 |
| InChIKey | BYNCMRVOOAGSAY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(azetidin-3-yl)ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)ethenol?
The IUPAC name of 1-(azetidin-3-yl)ethenol (CID 144905123) is 1-(azetidin-3-yl)ethenol.
What is the SMILES notation for 1-(azetidin-3-yl)ethenol?
The canonical SMILES for 1-(azetidin-3-yl)ethenol is C=C(O)C1CNC1.
What is the InChIKey of 1-(azetidin-3-yl)ethenol?
The InChIKey is BYNCMRVOOAGSAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-4(7)5-2-6-3-5/h5-7H,1-3H2.
What are the key properties of 1-(azetidin-3-yl)ethenol?
1-(azetidin-3-yl)ethenol has a molecular weight of 99.13 g/mol, XLogP of 0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)ethenol is sourced from PubChem (CID 144905123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).