C13H13N5OS — CID 1449052
5-[5-amino-1-(3,4-dimethylphenyl)pyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 1449052) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 5-[5-amino-1-(3,4-dimethylphenyl)pyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[5-amino-1-(3,4-dimethylphenyl)pyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 1449052 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 5-[5-amino-1-(3,4-dimethylphenyl)pyrazol-4-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccc(-n2ncc(-c3n[nH]c(=S)o3)c2N)cc1C |
| InChI | InChI=1S/C13H13N5OS/c1-7-3-4-9(5-8(7)2)18-11(14)10(6-15-18)12-16-17-13(20)19-12/h3-6H,14H2,1-2H3,(H,17,20) |
| InChIKey | OKHSTNRADUTOGJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|