C15H22OS — CID 144905275
5-[(2E,4Z)-1-methoxyhepta-2,4-dien-3-yl]sulfanyl-6-methylcyclohexa-1,3-diene (PubChem CID 144905275) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is 5-[(2E,4Z)-1-methoxyhepta-2,4-dien-3-yl]sulfanyl-6-methylcyclohexa-1,3-diene.
| Compound Name | 5-[(2E,4Z)-1-methoxyhepta-2,4-dien-3-yl]sulfanyl-6-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144905275 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 5-[(2E,4Z)-1-methoxyhepta-2,4-dien-3-yl]sulfanyl-6-methylcyclohexa-1,3-diene |
| SMILES | CC/C=C\C(=C/COC)SC1C=CC=CC1C |
| InChI | InChI=1S/C15H22OS/c1-4-5-9-14(11-12-16-3)17-15-10-7-6-8-13(15)2/h5-11,13,15H,4,12H2,1-3H3/b9-5-,14-11+ |
| InChIKey | BNPLEAQTBRNQIO-TXYUMNEKSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|