C14H20F3N3O — CID 144906370
(E)-N-cyclohexa-2,4-dien-1-yl-6,6,6-trifluoro-2,3-bis(methylamino)hex-2-enamide (PubChem CID 144906370) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is (E)-N-cyclohexa-2,4-dien-1-yl-6,6,6-trifluoro-2,3-bis(methylamino)hex-2-enamide.
| Compound Name | (E)-N-cyclohexa-2,4-dien-1-yl-6,6,6-trifluoro-2,3-bis(methylamino)hex-2-enamide |
|---|---|
| PubChem CID | 144906370 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (E)-N-cyclohexa-2,4-dien-1-yl-6,6,6-trifluoro-2,3-bis(methylamino)hex-2-enamide |
| SMILES | CN/C(CCC(F)(F)F)=C(/NC)C(=O)NC1C=CC=CC1 |
| InChI | InChI=1S/C14H20F3N3O/c1-18-11(8-9-14(15,16)17)12(19-2)13(21)20-10-6-4-3-5-7-10/h3-6,10,18-19H,7-9H2,1-2H3,(H,20,21)/b12-11+ |
| InChIKey | PWDDMHKQPRWTJV-VAWYXSNFSA-N |
| XLogP | 1.98 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|