C55H43NO — CID 144907267
N-(9,9-dimethylfluoren-2-yl)-N-[9-ethenyl-10-[(Z)-prop-1-enyl]phenanthren-3-yl]-7,7-dimethylfluoreno[4,3-b][1]benzofuran-10-amine (PubChem CID 144907267) has the molecular formula C55H43NO and a molecular weight of 733.95 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-N-[9-ethenyl-10-[(Z)-prop-1-enyl]phenanthren-3-yl]-7,7-dimethylfluoreno[4,3-b][1]benzofuran-10-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-N-[9-ethenyl-10-[(Z)-prop-1-enyl]phenanthren-3-yl]-7,7-dimethylfluoreno[4,3-b][1]benzofuran-10-amine |
|---|---|
| PubChem CID | 144907267 |
| Molecular Formula | C55H43NO |
| Molecular Weight | 733.95 g/mol |
| Exact Mass | 733.33 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-N-[9-ethenyl-10-[(Z)-prop-1-enyl]phenanthren-3-yl]-7,7-dimethylfluoreno[4,3-b][1]benzofuran-10-amine |
| SMILES | C=Cc1c(/C=C\C)c2ccc(N(c3ccc4c(c3)-c3c(ccc5c3oc3ccccc35)C4(C)C)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2c2ccccc12 |
| InChI | InChI=1S/C55H43NO/c1-7-15-37-36(8-2)38-16-9-10-17-39(38)45-30-33(22-25-40(37)45)56(35-23-26-42-41-18-11-13-20-47(41)55(5,6)50(42)32-35)34-24-28-48-46(31-34)52-49(54(48,3)4)29-27-44-43-19-12-14-21-51(43)57-53(44)52/h7-32H,2H2,1,3-6H3/b15-7- |
| InChIKey | CCTXRWZQDSKDQV-CHHVJCJISA-N |
| XLogP | 15.65 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.95 |
| LogP ≤ 5 | 15.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|