C26H22S5 — CID 144907747
5-[[4-methyl-3,5-bis(sulfanyl)phenyl]-diphenylmethyl]benzene-1,2,3-trithiol (PubChem CID 144907747) has the molecular formula C26H22S5 and a molecular weight of 494.80 g/mol. Its IUPAC name is 5-[[4-methyl-3,5-bis(sulfanyl)phenyl]-diphenylmethyl]benzene-1,2,3-trithiol.
| Compound Name | 5-[[4-methyl-3,5-bis(sulfanyl)phenyl]-diphenylmethyl]benzene-1,2,3-trithiol |
|---|---|
| PubChem CID | 144907747 |
| Molecular Formula | C26H22S5 |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 5-[[4-methyl-3,5-bis(sulfanyl)phenyl]-diphenylmethyl]benzene-1,2,3-trithiol |
| SMILES | Cc1c(S)cc(C(c2ccccc2)(c2ccccc2)c2cc(S)c(S)c(S)c2)cc1S |
| InChI | InChI=1S/C26H22S5/c1-16-21(27)12-19(13-22(16)28)26(17-8-4-2-5-9-17,18-10-6-3-7-11-18)20-14-23(29)25(31)24(30)15-20/h2-15,27-31H,1H3 |
| InChIKey | CREULSKRBDXTRP-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|