C28H33ClN4O5 — CID 144908150
2-[(22Z)-16-chloro-4,26-dimethyl-11,19,25-trioxa-1,5,7,8-tetrazapentacyclo[24.2.2.16,9.02,7.013,18]hentriaconta-2,4,6(31),8,13(18),14,16,22-octaen-3-yl]acetic acid (PubChem CID 144908150) has the molecular formula C28H33ClN4O5 and a molecular weight of 541.05 g/mol. Its IUPAC name is 2-[(22Z)-16-chloro-4,26-dimethyl-11,19,25-trioxa-1,5,7,8-tetrazapentacyclo[24.2.2.16,9.02,7.013,18]hentriaconta-2,4,6(31),8,13(18),14,16,22-octaen-3-yl]acetic acid.
| Compound Name | 2-[(22Z)-16-chloro-4,26-dimethyl-11,19,25-trioxa-1,5,7,8-tetrazapentacyclo[24.2.2.16,9.02,7.013,18]hentriaconta-2,4,6(31),8,13(18),14,16,22-octaen-3-yl]acetic acid |
|---|---|
| PubChem CID | 144908150 |
| Molecular Formula | C28H33ClN4O5 |
| Molecular Weight | 541.05 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-[(22Z)-16-chloro-4,26-dimethyl-11,19,25-trioxa-1,5,7,8-tetrazapentacyclo[24.2.2.16,9.02,7.013,18]hentriaconta-2,4,6(31),8,13(18),14,16,22-octaen-3-yl]acetic acid |
| SMILES | Cc1nc2cc3nn2c(c1CC(=O)O)N1CCC(C)(CC1)OC/C=C/CCOc1cc(Cl)ccc1COC3 |
| InChI | InChI=1S/C28H33ClN4O5/c1-19-23(16-26(34)35)27-32-10-8-28(2,9-11-32)38-13-5-3-4-12-37-24-14-21(29)7-6-20(24)17-36-18-22-15-25(30-19)33(27)31-22/h3,5-7,14-15H,4,8-13,16-18H2,1-2H3,(H,34,35)/b5-3+ |
| InChIKey | BIMSWOMJGVDAEG-HWKANZROSA-N |
| XLogP | 4.75 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.05 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|