C29H26BrN5O4 — CID 144908440
1-benzyl-5-bromo-3-nitroindole;ethane;N-(1H-indazol-3-yl)furan-3-carboxamide (PubChem CID 144908440) has the molecular formula C29H26BrN5O4 and a molecular weight of 588.46 g/mol. Its IUPAC name is 1-benzyl-5-bromo-3-nitroindole;ethane;N-(1H-indazol-3-yl)furan-3-carboxamide.
| Compound Name | 1-benzyl-5-bromo-3-nitroindole;ethane;N-(1H-indazol-3-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 144908440 |
| Molecular Formula | C29H26BrN5O4 |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 1-benzyl-5-bromo-3-nitroindole;ethane;N-(1H-indazol-3-yl)furan-3-carboxamide |
| SMILES | CC.O=C(Nc1n[nH]c2ccccc12)c1ccoc1.O=[N+]([O-])c1cn(Cc2ccccc2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C15H11BrN2O2.C12H9N3O2.C2H6/c16-12-6-7-14-13(8-12)15(18(19)20)10-17(14)9-11-4-2-1-3-5-11;16-12(8-5-6-17-7-8)13-11-9-3-1-2-4-10(9)14-15-11;1-2/h1-8,10H,9H2;1-7H,(H2,13,14,15,16);1-2H3 |
| InChIKey | XETIKEIQAJDWID-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|