About CID 144908474
CID 144908474 (PubChem CID 144908474) has the molecular formula C7H6AlBrN2O2
and a molecular weight of 257.02 g/mol.
Molecular Properties
| Compound Name | CID 144908474 |
| PubChem CID | 144908474 |
| Molecular Formula | C7H6AlBrN2O2 |
| Molecular Weight | 257.02 g/mol |
| Exact Mass | 255.94 |
| IUPAC Name | — |
| SMILES | O=C(NC[Al])c1cc(Br)c[nH]c1=O |
| InChI | InChI=1S/C7H6BrN2O2.Al/c1-9-6(11)5-2-4(8)3-10-7(5)12;/h2-3H,1H2,(H,9,11)(H,10,12); |
| InChIKey | KJTWRWYUEYRRFJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.02 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 144908474 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144908474?
The IUPAC name of CID 144908474 (CID 144908474) is not available.
What is the SMILES notation for CID 144908474?
The canonical SMILES for CID 144908474 is O=C(NC[Al])c1cc(Br)c[nH]c1=O.
What is the InChIKey of CID 144908474?
The InChIKey is KJTWRWYUEYRRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN2O2.Al/c1-9-6(11)5-2-4(8)3-10-7(5)12;/h2-3H,1H2,(H,9,11)(H,10,12);.
What are the key properties of CID 144908474?
CID 144908474 has a molecular weight of 257.02 g/mol, XLogP of -0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144908474 is sourced from PubChem (CID 144908474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).