About (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite
(4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite (PubChem CID 144908624) has the molecular formula C10H18INS
and a molecular weight of 311.23 g/mol. Its IUPAC name is (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite.
Molecular Properties
| Compound Name | (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite |
| PubChem CID | 144908624 |
| Molecular Formula | C10H18INS |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite |
| SMILES | C=C(CCC1CCCCC1)NSI |
| InChI | InChI=1S/C10H18INS/c1-9(12-13-11)7-8-10-5-3-2-4-6-10/h10,12H,1-8H2 |
| InChIKey | FLGQYYCZJMFWAR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite?
The IUPAC name of (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite (CID 144908624) is (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite.
What is the SMILES notation for (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite?
The canonical SMILES for (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite is C=C(CCC1CCCCC1)NSI.
What is the InChIKey of (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite?
The InChIKey is FLGQYYCZJMFWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18INS/c1-9(12-13-11)7-8-10-5-3-2-4-6-10/h10,12H,1-8H2.
What are the key properties of (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite?
(4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite has a molecular weight of 311.23 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclohexylbut-1-en-2-ylamino) thiohypoiodite is sourced from PubChem (CID 144908624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).