About 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate
5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate (PubChem CID 144908823) has the molecular formula C16H22N4O2
and a molecular weight of 302.38 g/mol. Its IUPAC name is 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate.
Molecular Properties
| Compound Name | 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate |
| PubChem CID | 144908823 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate |
| SMILES | C=CC.COc1cn(C)nc1-c1cnc2c(ccn2C)c1.O |
| InChI | InChI=1S/C13H14N4O.C3H6.H2O/c1-16-5-4-9-6-10(7-14-13(9)16)12-11(18-3)8-17(2)15-12;1-3-2;/h4-8H,1-3H3;3H,1H2,2H3;1H2 |
| InChIKey | JWSBLFGAJYDZRN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate?
The IUPAC name of 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate (CID 144908823) is 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate.
What is the SMILES notation for 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate?
The canonical SMILES for 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate is C=CC.COc1cn(C)nc1-c1cnc2c(ccn2C)c1.O.
What is the InChIKey of 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate?
The InChIKey is JWSBLFGAJYDZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O.C3H6.H2O/c1-16-5-4-9-6-10(7-14-13(9)16)12-11(18-3)8-17(2)15-12;1-3-2;/h4-8H,1-3H3;3H,1H2,2H3;1H2.
What are the key properties of 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate?
5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate has a molecular weight of 302.38 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxy-1-methylpyrazol-3-yl)-1-methylpyrrolo[2,3-b]pyridine;prop-1-ene;hydrate is sourced from PubChem (CID 144908823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).