About pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride
pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride (PubChem CID 144909195) has the molecular formula C6H4ClN3O
and a molecular weight of 169.57 g/mol. Its IUPAC name is pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride |
| PubChem CID | 144909195 |
| Molecular Formula | C6H4ClN3O |
| Molecular Weight | 169.57 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride |
| SMILES | Cl.O=C1N=CN=C2N=CC=C12 |
| InChI | InChI=1S/C6H3N3O.ClH/c10-6-4-1-2-7-5(4)8-3-9-6;/h1-3H;1H |
| InChIKey | BTYHYFCEBBEMFL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.57 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride?
The IUPAC name of pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride (CID 144909195) is pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride.
What is the SMILES notation for pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride?
The canonical SMILES for pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride is Cl.O=C1N=CN=C2N=CC=C12.
What is the InChIKey of pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride?
The InChIKey is BTYHYFCEBBEMFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O.ClH/c10-6-4-1-2-7-5(4)8-3-9-6;/h1-3H;1H.
What are the key properties of pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride?
pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride has a molecular weight of 169.57 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-d]pyrimidin-4-one;hydrochloride is sourced from PubChem (CID 144909195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).