C29H24F6O3 — CID 144909638
2,6-difluoro-4-(2-fluoro-4-methoxyphenyl)phenol;2,6-difluoro-4-(2-fluoro-4-methylphenyl)benzaldehyde;ethane (PubChem CID 144909638) has the molecular formula C29H24F6O3 and a molecular weight of 534.50 g/mol. Its IUPAC name is 2,6-difluoro-4-(2-fluoro-4-methoxyphenyl)phenol;2,6-difluoro-4-(2-fluoro-4-methylphenyl)benzaldehyde;ethane.
| Compound Name | 2,6-difluoro-4-(2-fluoro-4-methoxyphenyl)phenol;2,6-difluoro-4-(2-fluoro-4-methylphenyl)benzaldehyde;ethane |
|---|---|
| PubChem CID | 144909638 |
| Molecular Formula | C29H24F6O3 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 2,6-difluoro-4-(2-fluoro-4-methoxyphenyl)phenol;2,6-difluoro-4-(2-fluoro-4-methylphenyl)benzaldehyde;ethane |
| SMILES | CC.COc1ccc(-c2cc(F)c(O)c(F)c2)c(F)c1.Cc1ccc(-c2cc(F)c(C=O)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C14H9F3O.C13H9F3O2.C2H6/c1-8-2-3-10(12(15)4-8)9-5-13(16)11(7-18)14(17)6-9;1-18-8-2-3-9(10(14)6-8)7-4-11(15)13(17)12(16)5-7;1-2/h2-7H,1H3;2-6,17H,1H3;1-2H3 |
| InChIKey | IXWWLNKBFFLVHS-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|