C22H26F3N5O3 — CID 144910293
N-[5-methyl-2-[7-methyl-4-oxo-5-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-1,2,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]phenyl]acetamide (PubChem CID 144910293) has the molecular formula C22H26F3N5O3 and a molecular weight of 465.48 g/mol. Its IUPAC name is N-[5-methyl-2-[7-methyl-4-oxo-5-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-1,2,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]phenyl]acetamide.
| Compound Name | N-[5-methyl-2-[7-methyl-4-oxo-5-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-1,2,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 144910293 |
| Molecular Formula | C22H26F3N5O3 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-[5-methyl-2-[7-methyl-4-oxo-5-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-1,2,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C)ccc1C1C=C2C(=O)N(C3CCN(CC(F)(F)F)C3=O)CC(C)N2N1 |
| InChI | InChI=1S/C22H26F3N5O3/c1-12-4-5-15(16(8-12)26-14(3)31)17-9-19-21(33)29(10-13(2)30(19)27-17)18-6-7-28(20(18)32)11-22(23,24)25/h4-5,8-9,13,17-18,27H,6-7,10-11H2,1-3H3,(H,26,31) |
| InChIKey | SOHKLZVKSKQOJV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |