C26H29ClN4O2 — CID 144910524
2-[2-(4-chlorophenyl)-4-oxo-7-pentyl-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]-N-methyl-N-phenylacetamide (PubChem CID 144910524) has the molecular formula C26H29ClN4O2 and a molecular weight of 465.00 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-4-oxo-7-pentyl-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-4-oxo-7-pentyl-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 144910524 |
| Molecular Formula | C26H29ClN4O2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-4-oxo-7-pentyl-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]-N-methyl-N-phenylacetamide |
| SMILES | CCCCCC1CN(CC(=O)N(C)c2ccccc2)C(=O)c2cc(-c3ccc(Cl)cc3)nn21 |
| InChI | InChI=1S/C26H29ClN4O2/c1-3-4-6-11-22-17-30(18-25(32)29(2)21-9-7-5-8-10-21)26(33)24-16-23(28-31(22)24)19-12-14-20(27)15-13-19/h5,7-10,12-16,22H,3-4,6,11,17-18H2,1-2H3 |
| InChIKey | WTNGPVGWFMEALQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|